C20H21FN2O2S2 — CID 156748643
(E)-3-[[7-ethylsulfanyl-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enal (PubChem CID 156748643) has the molecular formula C20H21FN2O2S2 and a molecular weight of 404.53 g/mol. Its IUPAC name is (E)-3-[[7-ethylsulfanyl-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enal.
| Compound Name | (E)-3-[[7-ethylsulfanyl-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enal |
|---|---|
| PubChem CID | 156748643 |
| Molecular Formula | C20H21FN2O2S2 |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (E)-3-[[7-ethylsulfanyl-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enal |
| SMILES | CCSc1cc2c(cc1O/C=C/C=O)SN(C)CCN2c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN2O2S2/c1-3-26-20-13-17-19(14-18(20)25-12-4-11-24)27-22(2)9-10-23(17)16-7-5-15(21)6-8-16/h4-8,11-14H,3,9-10H2,1-2H3/b12-4+ |
| InChIKey | NJDHSZJFOMJYIX-UUILKARUSA-N |
| XLogP | 5.12 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|