C24H28FNO5S2 — CID 163389083
(E)-3-[[(3S)-3-butyl-7-ethylsulfanyl-5-(4-fluorophenyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid (PubChem CID 163389083) has the molecular formula C24H28FNO5S2 and a molecular weight of 493.62 g/mol. Its IUPAC name is (E)-3-[[(3S)-3-butyl-7-ethylsulfanyl-5-(4-fluorophenyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid.
| Compound Name | (E)-3-[[(3S)-3-butyl-7-ethylsulfanyl-5-(4-fluorophenyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 163389083 |
| Molecular Formula | C24H28FNO5S2 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | (E)-3-[[(3S)-3-butyl-7-ethylsulfanyl-5-(4-fluorophenyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
| SMILES | CCCC[C@H]1CN(c2ccc(F)cc2)c2cc(SCC)c(O/C=C/C(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C24H28FNO5S2/c1-3-5-6-17-15-26(19-9-7-18(25)8-10-19)20-13-22(32-4-2)21(31-12-11-24(27)28)14-23(20)33(29,30)16-17/h7-14,17H,3-6,15-16H2,1-2H3,(H,27,28)/b12-11+/t17-/m0/s1 |
| InChIKey | JSVRWOWCPRKLRL-FLVLSHQESA-N |
| XLogP | 5.65 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|