C27H36N2O5S2 — CID 175098963
3-[[5-(4-aminophenyl)-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid (PubChem CID 175098963) has the molecular formula C27H36N2O5S2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 3-[[5-(4-aminophenyl)-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid.
| Compound Name | 3-[[5-(4-aminophenyl)-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 175098963 |
| Molecular Formula | C27H36N2O5S2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 3-[[5-(4-aminophenyl)-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(N)cc2)c2cc(SC)c(OC=CC(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C27H36N2O5S2/c1-4-6-13-27(14-7-5-2)18-29(21-10-8-20(28)9-11-21)22-16-24(35-3)23(34-15-12-26(30)31)17-25(22)36(32,33)19-27/h8-12,15-17H,4-7,13-14,18-19,28H2,1-3H3,(H,30,31) |
| InChIKey | UIGNUDXZYFKVAA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|