C26H33NO4S2 — CID 159687373
(E)-4-[(3-butyl-3-ethyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]but-3-en-2-one (PubChem CID 159687373) has the molecular formula C26H33NO4S2 and a molecular weight of 487.69 g/mol. Its IUPAC name is (E)-4-[(3-butyl-3-ethyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]but-3-en-2-one.
| Compound Name | (E)-4-[(3-butyl-3-ethyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]but-3-en-2-one |
|---|---|
| PubChem CID | 159687373 |
| Molecular Formula | C26H33NO4S2 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | (E)-4-[(3-butyl-3-ethyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]but-3-en-2-one |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(SC)c(O/C=C/C(C)=O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C26H33NO4S2/c1-5-7-14-26(6-2)18-27(21-11-9-8-10-12-21)22-16-24(32-4)23(31-15-13-20(3)28)17-25(22)33(29,30)19-26/h8-13,15-17H,5-7,14,18-19H2,1-4H3/b15-13+ |
| InChIKey | JJEKPLLZMQDRSU-FYWRMAATSA-N |
| XLogP | 6.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|