C31H42N2O6S2 — CID 175102018
3-[[5-[4-(butanoylamino)phenyl]-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid (PubChem CID 175102018) has the molecular formula C31H42N2O6S2 and a molecular weight of 602.82 g/mol. Its IUPAC name is 3-[[5-[4-(butanoylamino)phenyl]-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid.
| Compound Name | 3-[[5-[4-(butanoylamino)phenyl]-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 175102018 |
| Molecular Formula | C31H42N2O6S2 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 3-[[5-[4-(butanoylamino)phenyl]-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(NC(=O)CCC)cc2)c2cc(SC)c(OC=CC(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C31H42N2O6S2/c1-5-8-16-31(17-9-6-2)21-33(24-13-11-23(12-14-24)32-29(34)10-7-3)25-19-27(40-4)26(39-18-15-30(35)36)20-28(25)41(37,38)22-31/h11-15,18-20H,5-10,16-17,21-22H2,1-4H3,(H,32,34)(H,35,36) |
| InChIKey | FOTUCOVROKAEER-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|