C32H44N2O4S2 — CID 146271914
(E)-3-[[3,3-dibutyl-5-[4-(2,2-dimethylpropanoylamino)phenyl]-7-methylsulfanyl-2,4-dihydro-1,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid (PubChem CID 146271914) has the molecular formula C32H44N2O4S2 and a molecular weight of 584.85 g/mol. Its IUPAC name is (E)-3-[[3,3-dibutyl-5-[4-(2,2-dimethylpropanoylamino)phenyl]-7-methylsulfanyl-2,4-dihydro-1,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid.
| Compound Name | (E)-3-[[3,3-dibutyl-5-[4-(2,2-dimethylpropanoylamino)phenyl]-7-methylsulfanyl-2,4-dihydro-1,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 146271914 |
| Molecular Formula | C32H44N2O4S2 |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | (E)-3-[[3,3-dibutyl-5-[4-(2,2-dimethylpropanoylamino)phenyl]-7-methylsulfanyl-2,4-dihydro-1,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CSc2cc(O/C=C/C(=O)O)c(SC)cc2N(c2ccc(NC(=O)C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C32H44N2O4S2/c1-7-9-16-32(17-10-8-2)21-34(24-13-11-23(12-14-24)33-30(37)31(3,4)5)25-19-28(39-6)26(20-27(25)40-22-32)38-18-15-29(35)36/h11-15,18-20H,7-10,16-17,21-22H2,1-6H3,(H,33,37)(H,35,36)/b18-15+ |
| InChIKey | ZNIILPIBDNRODY-OBGWFSINSA-N |
| XLogP | 8.98 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|