C28H35FN2O6S2 — CID 146268918
(Z)-3-[[5-[4-(2,2-dimethylpropanoylamino)phenyl]-3,3-diethyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268918) has the molecular formula C28H35FN2O6S2 and a molecular weight of 578.73 g/mol. Its IUPAC name is (Z)-3-[[5-[4-(2,2-dimethylpropanoylamino)phenyl]-3,3-diethyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[[5-[4-(2,2-dimethylpropanoylamino)phenyl]-3,3-diethyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268918 |
| Molecular Formula | C28H35FN2O6S2 |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | (Z)-3-[[5-[4-(2,2-dimethylpropanoylamino)phenyl]-3,3-diethyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCC1(CC)CN(c2ccc(NC(=O)C(C)(C)C)cc2)c2cc(SC)c(O/C=C(\F)C(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C28H35FN2O6S2/c1-7-28(8-2)16-31(19-11-9-18(10-12-19)30-26(34)27(3,4)5)21-13-23(38-6)22(37-15-20(29)25(32)33)14-24(21)39(35,36)17-28/h9-15H,7-8,16-17H2,1-6H3,(H,30,34)(H,32,33)/b20-15- |
| InChIKey | MLPXOVKAIYNTFM-HKWRFOASSA-N |
| XLogP | 6.40 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|