C33H46N2O6S2 — CID 146271994
(E)-3-[[3,3-dibutyl-5-[4-(3,3-dimethylbutanoylamino)phenyl]-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid (PubChem CID 146271994) has the molecular formula C33H46N2O6S2 and a molecular weight of 630.87 g/mol. Its IUPAC name is (E)-3-[[3,3-dibutyl-5-[4-(3,3-dimethylbutanoylamino)phenyl]-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid.
| Compound Name | (E)-3-[[3,3-dibutyl-5-[4-(3,3-dimethylbutanoylamino)phenyl]-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 146271994 |
| Molecular Formula | C33H46N2O6S2 |
| Molecular Weight | 630.87 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | (E)-3-[[3,3-dibutyl-5-[4-(3,3-dimethylbutanoylamino)phenyl]-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(NC(=O)CC(C)(C)C)cc2)c2cc(SC)c(O/C=C/C(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C33H46N2O6S2/c1-7-9-16-33(17-10-8-2)22-35(25-13-11-24(12-14-25)34-30(36)21-32(3,4)5)26-19-28(42-6)27(41-18-15-31(37)38)20-29(26)43(39,40)23-33/h11-15,18-20H,7-10,16-17,21-23H2,1-6H3,(H,34,36)(H,37,38)/b18-15+ |
| InChIKey | VMHFBOQXLZRZCI-OBGWFSINSA-N |
| XLogP | 8.05 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.87 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|