C29H37FN2O6S2 — CID 146271875
methyl (Z)-3-[[5-[4-(2,2-dimethylpropanoylamino)phenyl]-3,3-diethyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoate (PubChem CID 146271875) has the molecular formula C29H37FN2O6S2 and a molecular weight of 592.76 g/mol. Its IUPAC name is methyl (Z)-3-[[5-[4-(2,2-dimethylpropanoylamino)phenyl]-3,3-diethyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoate.
| Compound Name | methyl (Z)-3-[[5-[4-(2,2-dimethylpropanoylamino)phenyl]-3,3-diethyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 146271875 |
| Molecular Formula | C29H37FN2O6S2 |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | methyl (Z)-3-[[5-[4-(2,2-dimethylpropanoylamino)phenyl]-3,3-diethyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoate |
| SMILES | CCC1(CC)CN(c2ccc(NC(=O)C(C)(C)C)cc2)c2cc(SC)c(O/C=C(\F)C(=O)OC)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C29H37FN2O6S2/c1-8-29(9-2)17-32(20-12-10-19(11-13-20)31-27(34)28(3,4)5)22-14-24(39-7)23(15-25(22)40(35,36)18-29)38-16-21(30)26(33)37-6/h10-16H,8-9,17-18H2,1-7H3,(H,31,34)/b21-16- |
| InChIKey | OLZJUZMIGVVZPW-PGMHBOJBSA-N |
| XLogP | 6.49 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|