C24H31FN2O5S2 — CID 146268920
(Z)-3-[(3-butyl-3-ethyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268920) has the molecular formula C24H31FN2O5S2 and a molecular weight of 510.65 g/mol. Its IUPAC name is (Z)-3-[(3-butyl-3-ethyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[(3-butyl-3-ethyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268920 |
| Molecular Formula | C24H31FN2O5S2 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | (Z)-3-[(3-butyl-3-ethyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(SC)c(O/C=C(\F)C(=O)O)cc2S(O)(O)N1 |
| InChI | InChI=1S/C24H31FN2O5S2/c1-4-6-12-24(5-2)16-27(17-10-8-7-9-11-17)19-13-21(33-3)20(32-15-18(25)23(28)29)14-22(19)34(30,31)26-24/h7-11,13-15,26,30-31H,4-6,12,16H2,1-3H3,(H,28,29)/b18-15- |
| InChIKey | DYLJHJLYTCVZIF-SDXDJHTJSA-N |
| XLogP | 6.79 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|