C28H42N2O4S3 — CID 174200710
ethyl 2-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate (PubChem CID 174200710) has the molecular formula C28H42N2O4S3 and a molecular weight of 566.86 g/mol. Its IUPAC name is ethyl 2-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate.
| Compound Name | ethyl 2-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 174200710 |
| Molecular Formula | C28H42N2O4S3 |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | ethyl 2-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(CSCC(=O)OCC)cc2S(O)(O)N1 |
| InChI | InChI=1S/C28H42N2O4S3/c1-5-8-15-28(16-9-6-2)21-30(23-13-11-10-12-14-23)24-18-25(35-4)22(17-26(24)37(32,33)29-28)19-36-20-27(31)34-7-3/h10-14,17-18,29,32-33H,5-9,15-16,19-21H2,1-4H3 |
| InChIKey | HTPXSTFWSAMMQV-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |