C26H35FN2O5S2 — CID 146268869
3-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268869) has the molecular formula C26H35FN2O5S2 and a molecular weight of 538.71 g/mol. Its IUPAC name is 3-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | 3-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268869 |
| Molecular Formula | C26H35FN2O5S2 |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 3-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OC=C(F)C(=O)O)cc2S(O)(O)N1 |
| InChI | InChI=1S/C26H35FN2O5S2/c1-4-6-13-26(14-7-5-2)18-29(19-11-9-8-10-12-19)21-15-23(35-3)22(34-17-20(27)25(30)31)16-24(21)36(32,33)28-26/h8-12,15-17,28,32-33H,4-7,13-14,18H2,1-3H3,(H,30,31) |
| InChIKey | ZYTPZKBLJPSZTI-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|