C27H37FN2O5S2 — CID 155150228
(Z)-3-[[5-(4-aminophenyl)-3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid (PubChem CID 155150228) has the molecular formula C27H37FN2O5S2 and a molecular weight of 552.73 g/mol. Its IUPAC name is (Z)-3-[[5-(4-aminophenyl)-3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[[5-(4-aminophenyl)-3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 155150228 |
| Molecular Formula | C27H37FN2O5S2 |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | (Z)-3-[[5-(4-aminophenyl)-3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(N)cc2)c2cc(SC)c(O/C=C(\F)C(=O)O)cc2S(O)(O)C1 |
| InChI | InChI=1S/C27H37FN2O5S2/c1-4-6-12-27(13-7-5-2)17-30(20-10-8-19(29)9-11-20)22-14-24(36-3)23(35-16-21(28)26(31)32)15-25(22)37(33,34)18-27/h8-11,14-16,33-34H,4-7,12-13,17-18,29H2,1-3H3,(H,31,32)/b21-16- |
| InChIKey | USGVGMBNTSGOMR-PGMHBOJBSA-N |
| XLogP | 7.89 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|