C27H33BrFNO5S2 — CID 146272077
(Z)-3-[[5-(4-bromophenyl)-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146272077) has the molecular formula C27H33BrFNO5S2 and a molecular weight of 614.60 g/mol. Its IUPAC name is (Z)-3-[[5-(4-bromophenyl)-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[[5-(4-bromophenyl)-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146272077 |
| Molecular Formula | C27H33BrFNO5S2 |
| Molecular Weight | 614.60 g/mol |
| Exact Mass | 613.10 |
| IUPAC Name | (Z)-3-[[5-(4-bromophenyl)-3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(Br)cc2)c2cc(SC)c(O/C=C(\F)C(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C27H33BrFNO5S2/c1-4-6-12-27(13-7-5-2)17-30(20-10-8-19(28)9-11-20)22-14-24(36-3)23(35-16-21(29)26(31)32)15-25(22)37(33,34)18-27/h8-11,14-16H,4-7,12-13,17-18H2,1-3H3,(H,31,32)/b21-16- |
| InChIKey | ZRJLEZNIVWZPTK-PGMHBOJBSA-N |
| XLogP | 7.74 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.60 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|