C24H27ClFNO5S — CID 146268921
(Z)-3-[(3-butyl-7-chloro-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268921) has the molecular formula C24H27ClFNO5S and a molecular weight of 496.00 g/mol. Its IUPAC name is (Z)-3-[(3-butyl-7-chloro-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[(3-butyl-7-chloro-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268921 |
| Molecular Formula | C24H27ClFNO5S |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (Z)-3-[(3-butyl-7-chloro-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(Cl)c(O/C=C(\F)C(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C24H27ClFNO5S/c1-3-5-11-24(4-2)15-27(17-9-7-6-8-10-17)20-12-18(25)21(32-14-19(26)23(28)29)13-22(20)33(30,31)16-24/h6-10,12-14H,3-5,11,15-16H2,1-2H3,(H,28,29)/b19-14- |
| InChIKey | OAGILGSOCBIVIC-RGEXLXHISA-N |
| XLogP | 6.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|