C24H30ClNO5S — CID 175351071
3-[(3-butyl-7-chloro-3-ethyl-1,1-dihydroxy-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid (PubChem CID 175351071) has the molecular formula C24H30ClNO5S and a molecular weight of 480.03 g/mol. Its IUPAC name is 3-[(3-butyl-7-chloro-3-ethyl-1,1-dihydroxy-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid.
| Compound Name | 3-[(3-butyl-7-chloro-3-ethyl-1,1-dihydroxy-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 175351071 |
| Molecular Formula | C24H30ClNO5S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 3-[(3-butyl-7-chloro-3-ethyl-1,1-dihydroxy-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(Cl)c(OC=CC(=O)O)cc2S(O)(O)C1 |
| InChI | InChI=1S/C24H30ClNO5S/c1-3-5-12-24(4-2)16-26(18-9-7-6-8-10-18)20-14-19(25)21(31-13-11-23(27)28)15-22(20)32(29,30)17-24/h6-11,13-15,29-30H,3-5,12,16-17H2,1-2H3,(H,27,28) |
| InChIKey | BQGWAKFPNWHGNP-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|