C24H31NO5S — CID 175099978
3-[(3-butyl-3-ethyl-1,1-dihydroxy-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid (PubChem CID 175099978) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is 3-[(3-butyl-3-ethyl-1,1-dihydroxy-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid.
| Compound Name | 3-[(3-butyl-3-ethyl-1,1-dihydroxy-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 175099978 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 3-[(3-butyl-3-ethyl-1,1-dihydroxy-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2ccc(OC=CC(=O)O)cc2S(O)(O)C1 |
| InChI | InChI=1S/C24H31NO5S/c1-3-5-14-24(4-2)17-25(19-9-7-6-8-10-19)21-12-11-20(30-15-13-23(26)27)16-22(21)31(28,29)18-24/h6-13,15-16,28-29H,3-5,14,17-18H2,1-2H3,(H,26,27) |
| InChIKey | CBIJHZMDPMPFHU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|