C26H32ClNO5S — CID 146272107
ethyl (E)-3-[(3-butyl-7-chloro-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]prop-2-enoate (PubChem CID 146272107) has the molecular formula C26H32ClNO5S and a molecular weight of 506.06 g/mol. Its IUPAC name is ethyl (E)-3-[(3-butyl-7-chloro-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3-butyl-7-chloro-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]prop-2-enoate |
|---|---|
| PubChem CID | 146272107 |
| Molecular Formula | C26H32ClNO5S |
| Molecular Weight | 506.06 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | ethyl (E)-3-[(3-butyl-7-chloro-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]prop-2-enoate |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(Cl)c(O/C=C/C(=O)OCC)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C26H32ClNO5S/c1-4-7-14-26(5-2)18-28(20-11-9-8-10-12-20)22-16-21(27)23(17-24(22)34(30,31)19-26)33-15-13-25(29)32-6-3/h8-13,15-17H,4-7,14,18-19H2,1-3H3/b15-13+ |
| InChIKey | UKMNHPMYPYFIIT-FYWRMAATSA-N |
| XLogP | 6.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.06 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|