C29H39NO6S — CID 146272052
ethyl (Z)-3-[(3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]prop-2-enoate (PubChem CID 146272052) has the molecular formula C29H39NO6S and a molecular weight of 529.70 g/mol. Its IUPAC name is ethyl (Z)-3-[(3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]prop-2-enoate |
|---|---|
| PubChem CID | 146272052 |
| Molecular Formula | C29H39NO6S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | ethyl (Z)-3-[(3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]prop-2-enoate |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(OC)c(O/C=C\C(=O)OCC)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C29H39NO6S/c1-5-8-16-29(17-9-6-2)21-30(23-13-11-10-12-14-23)24-19-25(34-4)26(20-27(24)37(32,33)22-29)36-18-15-28(31)35-7-3/h10-15,18-20H,5-9,16-17,21-22H2,1-4H3/b18-15- |
| InChIKey | ZHOHJKZQDCTRBJ-SDXDJHTJSA-N |
| XLogP | 6.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|