C22H28INO3S — CID 146268789
3-butyl-3-ethyl-7-iodo-8-methoxy-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepine 1,1-dioxide (PubChem CID 146268789) has the molecular formula C22H28INO3S and a molecular weight of 513.44 g/mol. Its IUPAC name is 3-butyl-3-ethyl-7-iodo-8-methoxy-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepine 1,1-dioxide.
| Compound Name | 3-butyl-3-ethyl-7-iodo-8-methoxy-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 146268789 |
| Molecular Formula | C22H28INO3S |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 3-butyl-3-ethyl-7-iodo-8-methoxy-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepine 1,1-dioxide |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(I)c(OC)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C22H28INO3S/c1-4-6-12-22(5-2)15-24(17-10-8-7-9-11-17)19-13-18(23)20(27-3)14-21(19)28(25,26)16-22/h7-11,13-14H,4-6,12,15-16H2,1-3H3 |
| InChIKey | RHZOKPSGFGPTBK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|