C30H42N2O5S — CID 146272133
tert-butyl (E)-3-[[3-butyl-7-(dimethylamino)-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoate (PubChem CID 146272133) has the molecular formula C30H42N2O5S and a molecular weight of 542.74 g/mol. Its IUPAC name is tert-butyl (E)-3-[[3-butyl-7-(dimethylamino)-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[[3-butyl-7-(dimethylamino)-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoate |
|---|---|
| PubChem CID | 146272133 |
| Molecular Formula | C30H42N2O5S |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | tert-butyl (E)-3-[[3-butyl-7-(dimethylamino)-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]prop-2-enoate |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(N(C)C)c(O/C=C/C(=O)OC(C)(C)C)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C30H42N2O5S/c1-8-10-17-30(9-2)21-32(23-14-12-11-13-15-23)25-19-24(31(6)7)26(20-27(25)38(34,35)22-30)36-18-16-28(33)37-29(3,4)5/h11-16,18-20H,8-10,17,21-22H2,1-7H3/b18-16+ |
| InChIKey | LIOPAOJHHCOBKY-FBMGVBCBSA-N |
| XLogP | 6.50 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|