C24H28FNO3S — CID 146271750
(Z)-3-[(3-butyl-3-ethyl-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146271750) has the molecular formula C24H28FNO3S and a molecular weight of 429.56 g/mol. Its IUPAC name is (Z)-3-[(3-butyl-3-ethyl-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[(3-butyl-3-ethyl-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146271750 |
| Molecular Formula | C24H28FNO3S |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (Z)-3-[(3-butyl-3-ethyl-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CC)CSc2cc(O/C=C(\F)C(=O)O)ccc2N(c2ccccc2)C1 |
| InChI | InChI=1S/C24H28FNO3S/c1-3-5-13-24(4-2)16-26(18-9-7-6-8-10-18)21-12-11-19(14-22(21)30-17-24)29-15-20(25)23(27)28/h6-12,14-15H,3-5,13,16-17H2,1-2H3,(H,27,28)/b20-15- |
| InChIKey | DKYWCNLYZFNQIK-HKWRFOASSA-N |
| XLogP | 6.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|