C24H30F3NO5S2 — CID 177169368
[3-butyl-3-ethyl-7-methoxy-5-(4-methoxyphenyl)-2,4-dihydro-1,5-benzothiazepin-8-yl] trifluoromethanesulfonate (PubChem CID 177169368) has the molecular formula C24H30F3NO5S2 and a molecular weight of 533.63 g/mol. Its IUPAC name is [3-butyl-3-ethyl-7-methoxy-5-(4-methoxyphenyl)-2,4-dihydro-1,5-benzothiazepin-8-yl] trifluoromethanesulfonate.
| Compound Name | [3-butyl-3-ethyl-7-methoxy-5-(4-methoxyphenyl)-2,4-dihydro-1,5-benzothiazepin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 177169368 |
| Molecular Formula | C24H30F3NO5S2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | [3-butyl-3-ethyl-7-methoxy-5-(4-methoxyphenyl)-2,4-dihydro-1,5-benzothiazepin-8-yl] trifluoromethanesulfonate |
| SMILES | CCCCC1(CC)CSc2cc(OS(=O)(=O)C(F)(F)F)c(OC)cc2N(c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C24H30F3NO5S2/c1-5-7-12-23(6-2)15-28(17-8-10-18(31-3)11-9-17)19-13-20(32-4)21(14-22(19)34-16-23)33-35(29,30)24(25,26)27/h8-11,13-14H,5-7,12,15-16H2,1-4H3 |
| InChIKey | RNFMWTWFTUFDJM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|