C25H33F4NO6S2 — CID 174201509
[3,3-dibutyl-5-(4-fluorophenyl)-1,1-dihydroxy-7-methoxy-2,4-dihydro-1λ4,5-benzothiazepin-8-yl] trifluoromethanesulfonate (PubChem CID 174201509) has the molecular formula C25H33F4NO6S2 and a molecular weight of 583.67 g/mol. Its IUPAC name is [3,3-dibutyl-5-(4-fluorophenyl)-1,1-dihydroxy-7-methoxy-2,4-dihydro-1λ4,5-benzothiazepin-8-yl] trifluoromethanesulfonate.
| Compound Name | [3,3-dibutyl-5-(4-fluorophenyl)-1,1-dihydroxy-7-methoxy-2,4-dihydro-1λ4,5-benzothiazepin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174201509 |
| Molecular Formula | C25H33F4NO6S2 |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | [3,3-dibutyl-5-(4-fluorophenyl)-1,1-dihydroxy-7-methoxy-2,4-dihydro-1λ4,5-benzothiazepin-8-yl] trifluoromethanesulfonate |
| SMILES | CCCCC1(CCCC)CN(c2ccc(F)cc2)c2cc(OC)c(OS(=O)(=O)C(F)(F)F)cc2S(O)(O)C1 |
| InChI | InChI=1S/C25H33F4NO6S2/c1-4-6-12-24(13-7-5-2)16-30(19-10-8-18(26)9-11-19)20-14-21(35-3)22(15-23(20)37(31,32)17-24)36-38(33,34)25(27,28)29/h8-11,14-15,31-32H,4-7,12-13,16-17H2,1-3H3 |
| InChIKey | PMCLTHYKCWJUFZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|