C21H24F4N2O6S2 — CID 170940915
[3-butyl-5-(4-fluorophenyl)-7-methoxy-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl] trifluoromethanesulfonate (PubChem CID 170940915) has the molecular formula C21H24F4N2O6S2 and a molecular weight of 540.56 g/mol. Its IUPAC name is [3-butyl-5-(4-fluorophenyl)-7-methoxy-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl] trifluoromethanesulfonate.
| Compound Name | [3-butyl-5-(4-fluorophenyl)-7-methoxy-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 170940915 |
| Molecular Formula | C21H24F4N2O6S2 |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | [3-butyl-5-(4-fluorophenyl)-7-methoxy-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl] trifluoromethanesulfonate |
| SMILES | CCCCC1CN(c2ccc(F)cc2)c2cc(OC)c(OS(=O)(=O)C(F)(F)F)cc2S(=O)(=O)N1C |
| InChI | InChI=1S/C21H24F4N2O6S2/c1-4-5-6-16-13-27(15-9-7-14(22)8-10-15)17-11-18(32-3)19(33-35(30,31)21(23,24)25)12-20(17)34(28,29)26(16)2/h7-12,16H,4-6,13H2,1-3H3 |
| InChIKey | RBHCABHARXNACW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|