C21H25F3N2O4S2 — CID 170712095
(3-butyl-7-methoxy-2-methyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl) trifluoromethanesulfonate (PubChem CID 170712095) has the molecular formula C21H25F3N2O4S2 and a molecular weight of 490.57 g/mol. Its IUPAC name is (3-butyl-7-methoxy-2-methyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl) trifluoromethanesulfonate.
| Compound Name | (3-butyl-7-methoxy-2-methyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 170712095 |
| Molecular Formula | C21H25F3N2O4S2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | (3-butyl-7-methoxy-2-methyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl) trifluoromethanesulfonate |
| SMILES | CCCCC1CN(c2ccccc2)c2cc(OC)c(OS(=O)(=O)C(F)(F)F)cc2SN1C |
| InChI | InChI=1S/C21H25F3N2O4S2/c1-4-5-9-16-14-26(15-10-7-6-8-11-15)17-12-18(29-3)19(13-20(17)31-25(16)2)30-32(27,28)21(22,23)24/h6-8,10-13,16H,4-5,9,14H2,1-3H3 |
| InChIKey | MNYJBWJPODEQEQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|