C24H30F2N2O3S2 — CID 156748653
(Z)-3-[[3-butyl-5-(4-fluorophenyl)-2-methyl-7-methylsulfanyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enal;methanol (PubChem CID 156748653) has the molecular formula C24H30F2N2O3S2 and a molecular weight of 496.65 g/mol. Its IUPAC name is (Z)-3-[[3-butyl-5-(4-fluorophenyl)-2-methyl-7-methylsulfanyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enal;methanol.
| Compound Name | (Z)-3-[[3-butyl-5-(4-fluorophenyl)-2-methyl-7-methylsulfanyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enal;methanol |
|---|---|
| PubChem CID | 156748653 |
| Molecular Formula | C24H30F2N2O3S2 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (Z)-3-[[3-butyl-5-(4-fluorophenyl)-2-methyl-7-methylsulfanyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enal;methanol |
| SMILES | CCCCC1CN(c2ccc(F)cc2)c2cc(SC)c(O/C=C(\F)C=O)cc2SN1C.CO |
| InChI | InChI=1S/C23H26F2N2O2S2.CH4O/c1-4-5-6-19-13-27(18-9-7-16(24)8-10-18)20-11-23(30-3)21(29-15-17(25)14-28)12-22(20)31-26(19)2;1-2/h7-12,14-15,19H,4-6,13H2,1-3H3;2H,1H3/b17-15-; |
| InChIKey | PFSKXJSBDIMMCR-NYDCQJDFSA-N |
| XLogP | 6.19 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|