C26H34N4O3S2 — CID 169161967
3-[2-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)oxy]ethyl]-1-methylimidazolidine-2,4-dione (PubChem CID 169161967) has the molecular formula C26H34N4O3S2 and a molecular weight of 514.72 g/mol. Its IUPAC name is 3-[2-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)oxy]ethyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)oxy]ethyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 169161967 |
| Molecular Formula | C26H34N4O3S2 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 3-[2-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)oxy]ethyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CCCCC1CN(c2ccccc2)c2cc(SC)c(OCCN3C(=O)CN(C)C3=O)cc2SN1C |
| InChI | InChI=1S/C26H34N4O3S2/c1-5-6-10-20-17-30(19-11-8-7-9-12-19)21-15-24(34-4)22(16-23(21)35-28(20)3)33-14-13-29-25(31)18-27(2)26(29)32/h7-9,11-12,15-16,20H,5-6,10,13-14,17-18H2,1-4H3 |
| InChIKey | MRDZAQMCLMPCDF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|