C20H26N2O2S — CID 170712086
3-butyl-7-methoxy-2-methyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-ol (PubChem CID 170712086) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 3-butyl-7-methoxy-2-methyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-ol.
| Compound Name | 3-butyl-7-methoxy-2-methyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-ol |
|---|---|
| PubChem CID | 170712086 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3-butyl-7-methoxy-2-methyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-ol |
| SMILES | CCCCC1CN(c2ccccc2)c2cc(OC)c(O)cc2SN1C |
| InChI | InChI=1S/C20H26N2O2S/c1-4-5-9-16-14-22(15-10-7-6-8-11-15)17-12-19(24-3)18(23)13-20(17)25-21(16)2/h6-8,10-13,16,23H,4-5,9,14H2,1-3H3 |
| InChIKey | FTSBUUBEVDUVLR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|