C22H28N2O3S2 — CID 170712185
2-[(3-butyl-7-methoxy-5-phenyl-3,4-dihydro-2H-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetic acid (PubChem CID 170712185) has the molecular formula C22H28N2O3S2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 2-[(3-butyl-7-methoxy-5-phenyl-3,4-dihydro-2H-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetic acid.
| Compound Name | 2-[(3-butyl-7-methoxy-5-phenyl-3,4-dihydro-2H-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 170712185 |
| Molecular Formula | C22H28N2O3S2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[(3-butyl-7-methoxy-5-phenyl-3,4-dihydro-2H-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetic acid |
| SMILES | CCCCC1CN(c2ccccc2)c2cc(OC)c(CSCC(=O)O)cc2SN1 |
| InChI | InChI=1S/C22H28N2O3S2/c1-3-4-8-17-13-24(18-9-6-5-7-10-18)19-12-20(27-2)16(11-21(19)29-23-17)14-28-15-22(25)26/h5-7,9-12,17,23H,3-4,8,13-15H2,1-2H3,(H,25,26) |
| InChIKey | SOKIUFUMHKFDCE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|