C28H40N2O2S3 — CID 170712035
ethyl 2-[(3,3-dibutyl-7-methylsulfanyl-5-phenyl-2,4-dihydro-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate (PubChem CID 170712035) has the molecular formula C28H40N2O2S3 and a molecular weight of 532.84 g/mol. Its IUPAC name is ethyl 2-[(3,3-dibutyl-7-methylsulfanyl-5-phenyl-2,4-dihydro-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate.
| Compound Name | ethyl 2-[(3,3-dibutyl-7-methylsulfanyl-5-phenyl-2,4-dihydro-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 170712035 |
| Molecular Formula | C28H40N2O2S3 |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | ethyl 2-[(3,3-dibutyl-7-methylsulfanyl-5-phenyl-2,4-dihydro-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(CSCC(=O)OCC)cc2SN1 |
| InChI | InChI=1S/C28H40N2O2S3/c1-5-8-15-28(16-9-6-2)21-30(23-13-11-10-12-14-23)24-18-25(33-4)22(17-26(24)35-29-28)19-34-20-27(31)32-7-3/h10-14,17-18,29H,5-9,15-16,19-21H2,1-4H3 |
| InChIKey | VWVJTBFPXZRFLG-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|