C20H26N2OS — CID 57123939
3-butyl-3-ethyl-5-phenyl-2,4-dihydro-1,2,5-benzothiadiazepin-8-ol (PubChem CID 57123939) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 3-butyl-3-ethyl-5-phenyl-2,4-dihydro-1,2,5-benzothiadiazepin-8-ol.
| Compound Name | 3-butyl-3-ethyl-5-phenyl-2,4-dihydro-1,2,5-benzothiadiazepin-8-ol |
|---|---|
| PubChem CID | 57123939 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-butyl-3-ethyl-5-phenyl-2,4-dihydro-1,2,5-benzothiadiazepin-8-ol |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2ccc(O)cc2SN1 |
| InChI | InChI=1S/C20H26N2OS/c1-3-5-13-20(4-2)15-22(16-9-7-6-8-10-16)18-12-11-17(23)14-19(18)24-21-20/h6-12,14,21,23H,3-5,13,15H2,1-2H3 |
| InChIKey | LRQBWVHXSSIRLE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|