C29H42N2O2S3 — CID 170712143
ethyl 2-[(3,3-dibutyl-2-methyl-7-methylsulfanyl-5-phenyl-4H-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate (PubChem CID 170712143) has the molecular formula C29H42N2O2S3 and a molecular weight of 546.87 g/mol. Its IUPAC name is ethyl 2-[(3,3-dibutyl-2-methyl-7-methylsulfanyl-5-phenyl-4H-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate.
| Compound Name | ethyl 2-[(3,3-dibutyl-2-methyl-7-methylsulfanyl-5-phenyl-4H-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 170712143 |
| Molecular Formula | C29H42N2O2S3 |
| Molecular Weight | 546.87 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | ethyl 2-[(3,3-dibutyl-2-methyl-7-methylsulfanyl-5-phenyl-4H-1,2,5-benzothiadiazepin-8-yl)methylsulfanyl]acetate |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(CSCC(=O)OCC)cc2SN1C |
| InChI | InChI=1S/C29H42N2O2S3/c1-6-9-16-29(17-10-7-2)22-31(24-14-12-11-13-15-24)25-19-26(34-5)23(18-27(25)36-30(29)4)20-35-21-28(32)33-8-3/h11-15,18-19H,6-10,16-17,20-22H2,1-5H3 |
| InChIKey | RBSWMRSMZYRXKQ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.87 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|