C25H31FN2O3S2 — CID 146272172
(Z)-3-[(3-butyl-3-ethyl-2-methyl-7-methylsulfanyl-5-phenyl-4H-1,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146272172) has the molecular formula C25H31FN2O3S2 and a molecular weight of 490.67 g/mol. Its IUPAC name is (Z)-3-[(3-butyl-3-ethyl-2-methyl-7-methylsulfanyl-5-phenyl-4H-1,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[(3-butyl-3-ethyl-2-methyl-7-methylsulfanyl-5-phenyl-4H-1,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146272172 |
| Molecular Formula | C25H31FN2O3S2 |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (Z)-3-[(3-butyl-3-ethyl-2-methyl-7-methylsulfanyl-5-phenyl-4H-1,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(SC)c(O/C=C(\F)C(=O)O)cc2SN1C |
| InChI | InChI=1S/C25H31FN2O3S2/c1-5-7-13-25(6-2)17-28(18-11-9-8-10-12-18)20-14-23(32-4)21(15-22(20)33-27(25)3)31-16-19(26)24(29)30/h8-12,14-16H,5-7,13,17H2,1-4H3,(H,29,30)/b19-16- |
| InChIKey | GODMWBXKDKMACC-MNDPQUGUSA-N |
| XLogP | 7.11 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|