C20H20FNO3S2 — CID 156748680
(Z)-2-fluoro-3-[(3-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid (PubChem CID 156748680) has the molecular formula C20H20FNO3S2 and a molecular weight of 405.52 g/mol. Its IUPAC name is (Z)-2-fluoro-3-[(3-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid.
| Compound Name | (Z)-2-fluoro-3-[(3-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 156748680 |
| Molecular Formula | C20H20FNO3S2 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (Z)-2-fluoro-3-[(3-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid |
| SMILES | CSc1cc2c(cc1O/C=C(\F)C(=O)O)SCC(C)CN2c1ccccc1 |
| InChI | InChI=1S/C20H20FNO3S2/c1-13-10-22(14-6-4-3-5-7-14)16-8-19(26-2)17(9-18(16)27-12-13)25-11-15(21)20(23)24/h3-9,11,13H,10,12H2,1-2H3,(H,23,24)/b15-11- |
| InChIKey | QVZXQURRFGQOMS-PTNGSMBKSA-N |
| XLogP | 5.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|