C27H30FN3O2S2 — CID 170192700
3-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)amino]-2-fluorobenzoic acid (PubChem CID 170192700) has the molecular formula C27H30FN3O2S2 and a molecular weight of 511.69 g/mol. Its IUPAC name is 3-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)amino]-2-fluorobenzoic acid.
| Compound Name | 3-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 170192700 |
| Molecular Formula | C27H30FN3O2S2 |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 3-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)amino]-2-fluorobenzoic acid |
| SMILES | CCCCC1CN(c2ccccc2)c2cc(SC)c(Nc3cccc(C(=O)O)c3F)cc2SN1C |
| InChI | InChI=1S/C27H30FN3O2S2/c1-4-5-10-19-17-31(18-11-7-6-8-12-18)23-16-24(34-3)22(15-25(23)35-30(19)2)29-21-14-9-13-20(26(21)28)27(32)33/h6-9,11-16,19,29H,4-5,10,17H2,1-3H3,(H,32,33) |
| InChIKey | GPVDVAFIWXJLNR-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|