C25H33FN2O5S2 — CID 166505264
3-[[(3S)-3-butyl-5-(4-fluorophenyl)-2-methyl-7-methylsulfanyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]-2,2-dimethylpropanoic acid (PubChem CID 166505264) has the molecular formula C25H33FN2O5S2 and a molecular weight of 524.68 g/mol. Its IUPAC name is 3-[[(3S)-3-butyl-5-(4-fluorophenyl)-2-methyl-7-methylsulfanyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[(3S)-3-butyl-5-(4-fluorophenyl)-2-methyl-7-methylsulfanyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 166505264 |
| Molecular Formula | C25H33FN2O5S2 |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 3-[[(3S)-3-butyl-5-(4-fluorophenyl)-2-methyl-7-methylsulfanyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]-2,2-dimethylpropanoic acid |
| SMILES | CCCC[C@H]1CN(c2ccc(F)cc2)c2cc(SC)c(OCC(C)(C)C(=O)O)cc2S(=O)(=O)N1C |
| InChI | InChI=1S/C25H33FN2O5S2/c1-6-7-8-19-15-28(18-11-9-17(26)10-12-18)20-13-22(34-5)21(33-16-25(2,3)24(29)30)14-23(20)35(31,32)27(19)4/h9-14,19H,6-8,15-16H2,1-5H3,(H,29,30)/t19-/m0/s1 |
| InChIKey | CYLDWZDUTYTDDZ-IBGZPJMESA-N |
| XLogP | 5.37 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |