C20H25FN2O3S2 — CID 169162413
3-(4-fluorobutyl)-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-ol (PubChem CID 169162413) has the molecular formula C20H25FN2O3S2 and a molecular weight of 424.56 g/mol. Its IUPAC name is 3-(4-fluorobutyl)-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-ol.
| Compound Name | 3-(4-fluorobutyl)-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-ol |
|---|---|
| PubChem CID | 169162413 |
| Molecular Formula | C20H25FN2O3S2 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 3-(4-fluorobutyl)-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-ol |
| SMILES | CSc1cc2c(cc1O)S(=O)(=O)N(C)C(CCCCF)CN2c1ccccc1 |
| InChI | InChI=1S/C20H25FN2O3S2/c1-22-16(10-6-7-11-21)14-23(15-8-4-3-5-9-15)17-12-19(27-2)18(24)13-20(17)28(22,25)26/h3-5,8-9,12-13,16,24H,6-7,10-11,14H2,1-2H3 |
| InChIKey | UELGPMCXZJGJJX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|