C20H24N2O3S2 — CID 169162475
3-but-3-enyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-ol (PubChem CID 169162475) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is 3-but-3-enyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-ol.
| Compound Name | 3-but-3-enyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-ol |
|---|---|
| PubChem CID | 169162475 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 3-but-3-enyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-ol |
| SMILES | C=CCCC1CN(c2ccccc2)c2cc(SC)c(O)cc2S(=O)(=O)N1C |
| InChI | InChI=1S/C20H24N2O3S2/c1-4-5-9-16-14-22(15-10-7-6-8-11-15)17-12-19(26-3)18(23)13-20(17)27(24,25)21(16)2/h4,6-8,10-13,16,23H,1,5,9,14H2,2-3H3 |
| InChIKey | LRAUFNNBWFFSGJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|