C26H31F3N2O5S2 — CID 170196290
tert-butyl (E)-3-[[2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3-(3,3,3-trifluoropropyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoate (PubChem CID 170196290) has the molecular formula C26H31F3N2O5S2 and a molecular weight of 572.67 g/mol. Its IUPAC name is tert-butyl (E)-3-[[2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3-(3,3,3-trifluoropropyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[[2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3-(3,3,3-trifluoropropyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoate |
|---|---|
| PubChem CID | 170196290 |
| Molecular Formula | C26H31F3N2O5S2 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | tert-butyl (E)-3-[[2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3-(3,3,3-trifluoropropyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoate |
| SMILES | CSc1cc2c(cc1O/C=C/C(=O)OC(C)(C)C)S(=O)(=O)N(C)C(CCC(F)(F)F)CN2c1ccccc1 |
| InChI | InChI=1S/C26H31F3N2O5S2/c1-25(2,3)36-24(32)12-14-35-21-16-23-20(15-22(21)37-5)31(18-9-7-6-8-10-18)17-19(11-13-26(27,28)29)30(4)38(23,33)34/h6-10,12,14-16,19H,11,13,17H2,1-5H3/b14-12+ |
| InChIKey | IPMJDFYLRVBCFW-WYMLVPIESA-N |
| XLogP | 6.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|