C23H26N2O5S2 — CID 169162465
(E)-3-[[(3R)-3-but-3-enyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoic acid (PubChem CID 169162465) has the molecular formula C23H26N2O5S2 and a molecular weight of 474.60 g/mol. Its IUPAC name is (E)-3-[[(3R)-3-but-3-enyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoic acid.
| Compound Name | (E)-3-[[(3R)-3-but-3-enyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 169162465 |
| Molecular Formula | C23H26N2O5S2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | (E)-3-[[(3R)-3-but-3-enyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoic acid |
| SMILES | C=CCC[C@@H]1CN(c2ccccc2)c2cc(SC)c(O/C=C/C(=O)O)cc2S(=O)(=O)N1C |
| InChI | InChI=1S/C23H26N2O5S2/c1-4-5-9-18-16-25(17-10-7-6-8-11-17)19-14-21(31-3)20(30-13-12-23(26)27)15-22(19)32(28,29)24(18)2/h4,6-8,10-15,18H,1,5,9,16H2,2-3H3,(H,26,27)/b13-12+/t18-/m1/s1 |
| InChIKey | MCOJBBBSKSVFNK-QFQMRYFISA-N |
| XLogP | 4.49 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|