C30H37F3N2O8S3 — CID 174203999
[3-butyl-3-ethyl-1,1-dihydroxy-2-[(4-methoxyphenyl)methyl]-7-methylsulfonyl-5-phenyl-4H-1λ4,2,5-benzothiadiazepin-8-yl] trifluoromethanesulfonate (PubChem CID 174203999) has the molecular formula C30H37F3N2O8S3 and a molecular weight of 706.83 g/mol. Its IUPAC name is [3-butyl-3-ethyl-1,1-dihydroxy-2-[(4-methoxyphenyl)methyl]-7-methylsulfonyl-5-phenyl-4H-1λ4,2,5-benzothiadiazepin-8-yl] trifluoromethanesulfonate.
| Compound Name | [3-butyl-3-ethyl-1,1-dihydroxy-2-[(4-methoxyphenyl)methyl]-7-methylsulfonyl-5-phenyl-4H-1λ4,2,5-benzothiadiazepin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174203999 |
| Molecular Formula | C30H37F3N2O8S3 |
| Molecular Weight | 706.83 g/mol |
| Exact Mass | 706.17 |
| IUPAC Name | [3-butyl-3-ethyl-1,1-dihydroxy-2-[(4-methoxyphenyl)methyl]-7-methylsulfonyl-5-phenyl-4H-1λ4,2,5-benzothiadiazepin-8-yl] trifluoromethanesulfonate |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(S(C)(=O)=O)c(OS(=O)(=O)C(F)(F)F)cc2S(O)(O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H37F3N2O8S3/c1-5-7-17-29(6-2)21-34(23-11-9-8-10-12-23)25-18-28(44(4,36)37)26(43-46(40,41)30(31,32)33)19-27(25)45(38,39)35(29)20-22-13-15-24(42-3)16-14-22/h8-16,18-19,38-39H,5-7,17,20-21H2,1-4H3 |
| InChIKey | YNEIXINYOJBKTA-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.83 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|