C22H28F3N2O5PS3 — CID 174199086
(3-butyl-3-methyl-2-methylphosphanyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-4H-1λ6,2,5-benzothiadiazepin-8-yl) trifluoromethanesulfonate (PubChem CID 174199086) has the molecular formula C22H28F3N2O5PS3 and a molecular weight of 584.64 g/mol. Its IUPAC name is (3-butyl-3-methyl-2-methylphosphanyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-4H-1λ6,2,5-benzothiadiazepin-8-yl) trifluoromethanesulfonate.
| Compound Name | (3-butyl-3-methyl-2-methylphosphanyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-4H-1λ6,2,5-benzothiadiazepin-8-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174199086 |
| Molecular Formula | C22H28F3N2O5PS3 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | (3-butyl-3-methyl-2-methylphosphanyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-4H-1λ6,2,5-benzothiadiazepin-8-yl) trifluoromethanesulfonate |
| SMILES | CCCCC1(C)CN(c2ccccc2)c2cc(SC)c(OS(=O)(=O)C(F)(F)F)cc2S(=O)(=O)N1PC |
| InChI | InChI=1S/C22H28F3N2O5PS3/c1-5-6-12-21(2)15-26(16-10-8-7-9-11-16)17-13-19(34-4)18(32-36(30,31)22(23,24)25)14-20(17)35(28,29)27(21)33-3/h7-11,13-14,33H,5-6,12,15H2,1-4H3 |
| InChIKey | BZMYEVIHTZRHLU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|