C35H44FN3O6S — CID 146268830
(Z)-3-[[3,3-dibutyl-7-(dimethylamino)-2-[(4-methoxyphenyl)methyl]-1,1-dioxo-5-phenyl-4H-1λ6,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268830) has the molecular formula C35H44FN3O6S and a molecular weight of 653.82 g/mol. Its IUPAC name is (Z)-3-[[3,3-dibutyl-7-(dimethylamino)-2-[(4-methoxyphenyl)methyl]-1,1-dioxo-5-phenyl-4H-1λ6,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[[3,3-dibutyl-7-(dimethylamino)-2-[(4-methoxyphenyl)methyl]-1,1-dioxo-5-phenyl-4H-1λ6,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268830 |
| Molecular Formula | C35H44FN3O6S |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.29 |
| IUPAC Name | (Z)-3-[[3,3-dibutyl-7-(dimethylamino)-2-[(4-methoxyphenyl)methyl]-1,1-dioxo-5-phenyl-4H-1λ6,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(N(C)C)c(O/C=C(\F)C(=O)O)cc2S(=O)(=O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C35H44FN3O6S/c1-6-8-19-35(20-9-7-2)25-38(27-13-11-10-12-14-27)31-21-30(37(3)4)32(45-24-29(36)34(40)41)22-33(31)46(42,43)39(35)23-26-15-17-28(44-5)18-16-26/h10-18,21-22,24H,6-9,19-20,23,25H2,1-5H3,(H,40,41)/b29-24- |
| InChIKey | JUSQNQPKCSDBQK-OLFWJLLRSA-N |
| XLogP | 7.50 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|