C29H38BrNO4S2 — CID 146271823
ethyl (E)-3-[[5-(4-bromophenyl)-3,3-dibutyl-7-methylsulfanyl-1-oxo-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]prop-2-enoate (PubChem CID 146271823) has the molecular formula C29H38BrNO4S2 and a molecular weight of 608.66 g/mol. Its IUPAC name is ethyl (E)-3-[[5-(4-bromophenyl)-3,3-dibutyl-7-methylsulfanyl-1-oxo-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]prop-2-enoate.
| Compound Name | ethyl (E)-3-[[5-(4-bromophenyl)-3,3-dibutyl-7-methylsulfanyl-1-oxo-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]prop-2-enoate |
|---|---|
| PubChem CID | 146271823 |
| Molecular Formula | C29H38BrNO4S2 |
| Molecular Weight | 608.66 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | ethyl (E)-3-[[5-(4-bromophenyl)-3,3-dibutyl-7-methylsulfanyl-1-oxo-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]prop-2-enoate |
| SMILES | CCCCC1(CCCC)CN(c2ccc(Br)cc2)c2cc(SC)c(O/C=C/C(=O)OCC)cc2S(=O)C1 |
| InChI | InChI=1S/C29H38BrNO4S2/c1-5-8-15-29(16-9-6-2)20-31(23-12-10-22(30)11-13-23)24-18-26(36-4)25(19-27(24)37(33)21-29)35-17-14-28(32)34-7-3/h10-14,17-19H,5-9,15-16,20-21H2,1-4H3/b17-14+ |
| InChIKey | LMFWXLOWWSDMEL-SAPNQHFASA-N |
| XLogP | 8.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.66 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|