C28H37NO4S — CID 146271943
(E)-3-[(3,3-dibutyl-7-ethyl-1-oxo-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid (PubChem CID 146271943) has the molecular formula C28H37NO4S and a molecular weight of 483.67 g/mol. Its IUPAC name is (E)-3-[(3,3-dibutyl-7-ethyl-1-oxo-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid.
| Compound Name | (E)-3-[(3,3-dibutyl-7-ethyl-1-oxo-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 146271943 |
| Molecular Formula | C28H37NO4S |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (E)-3-[(3,3-dibutyl-7-ethyl-1-oxo-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(CC)c(O/C=C/C(=O)O)cc2S(=O)C1 |
| InChI | InChI=1S/C28H37NO4S/c1-4-7-15-28(16-8-5-2)20-29(23-12-10-9-11-13-23)24-18-22(6-3)25(33-17-14-27(30)31)19-26(24)34(32)21-28/h9-14,17-19H,4-8,15-16,20-21H2,1-3H3,(H,30,31)/b17-14+ |
| InChIKey | LDKAKVSHYTUMPB-SAPNQHFASA-N |
| XLogP | 6.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|