C28H37NO4S2 — CID 146271864
ethyl (E)-3-[(3-butyl-3-ethyl-7-ethylsulfanyl-1-oxo-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoate (PubChem CID 146271864) has the molecular formula C28H37NO4S2 and a molecular weight of 515.74 g/mol. Its IUPAC name is ethyl (E)-3-[(3-butyl-3-ethyl-7-ethylsulfanyl-1-oxo-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3-butyl-3-ethyl-7-ethylsulfanyl-1-oxo-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoate |
|---|---|
| PubChem CID | 146271864 |
| Molecular Formula | C28H37NO4S2 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | ethyl (E)-3-[(3-butyl-3-ethyl-7-ethylsulfanyl-1-oxo-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]prop-2-enoate |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(SCC)c(O/C=C/C(=O)OCC)cc2S(=O)C1 |
| InChI | InChI=1S/C28H37NO4S2/c1-5-9-16-28(6-2)20-29(22-13-11-10-12-14-22)23-18-25(34-8-4)24(19-26(23)35(31)21-28)33-17-15-27(30)32-7-3/h10-15,17-19H,5-9,16,20-21H2,1-4H3/b17-15+ |
| InChIKey | KNZSVYZQRPKKSR-BMRADRMJSA-N |
| XLogP | 7.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|