C29H39NO3S2 — CID 169162425
2-methylbutan-2-yl (E)-3-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl)oxy]prop-2-enoate (PubChem CID 169162425) has the molecular formula C29H39NO3S2 and a molecular weight of 513.77 g/mol. Its IUPAC name is 2-methylbutan-2-yl (E)-3-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl)oxy]prop-2-enoate.
| Compound Name | 2-methylbutan-2-yl (E)-3-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl)oxy]prop-2-enoate |
|---|---|
| PubChem CID | 169162425 |
| Molecular Formula | C29H39NO3S2 |
| Molecular Weight | 513.77 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 2-methylbutan-2-yl (E)-3-[(3-butyl-2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl)oxy]prop-2-enoate |
| SMILES | CCCCC1CN(c2ccccc2)c2cc(SC)c(O/C=C/C(=O)OC(C)(C)CC)cc2SC1C |
| InChI | InChI=1S/C29H39NO3S2/c1-7-9-13-22-20-30(23-14-11-10-12-15-23)24-18-27(34-6)25(19-26(24)35-21(22)3)32-17-16-28(31)33-29(4,5)8-2/h10-12,14-19,21-22H,7-9,13,20H2,1-6H3/b17-16+ |
| InChIKey | TZHOFJHXLPYGNO-WUKNDPDISA-N |
| XLogP | 8.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.77 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|