C19H22N2O3S2 — CID 166153062
2-hydroxy-3-[(2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)oxy]propanal (PubChem CID 166153062) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)oxy]propanal.
| Compound Name | 2-hydroxy-3-[(2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)oxy]propanal |
|---|---|
| PubChem CID | 166153062 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-hydroxy-3-[(2-methyl-7-methylsulfanyl-5-phenyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl)oxy]propanal |
| SMILES | CSc1cc2c(cc1OCC(O)C=O)SN(C)CCN2c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-20-8-9-21(14-6-4-3-5-7-14)16-10-19(25-2)17(11-18(16)26-20)24-13-15(23)12-22/h3-7,10-12,15,23H,8-9,13H2,1-2H3 |
| InChIKey | IXKMKUCNLPJANW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|