C25H39ClN4O4Si — CID 174057627
[(4S)-4-(3-amino-2-chlorophenyl)-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclohexyl]-4-methyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid (PubChem CID 174057627) has the molecular formula C25H39ClN4O4Si and a molecular weight of 523.15 g/mol. Its IUPAC name is [(4S)-4-(3-amino-2-chlorophenyl)-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclohexyl]-4-methyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid.
| Compound Name | [(4S)-4-(3-amino-2-chlorophenyl)-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclohexyl]-4-methyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174057627 |
| Molecular Formula | C25H39ClN4O4Si |
| Molecular Weight | 523.15 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | [(4S)-4-(3-amino-2-chlorophenyl)-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclohexyl]-4-methyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid |
| SMILES | CC1CC(N2C(=O)C[C@@](C)(c3cccc(N)c3Cl)N=C2NC(=O)O)CCC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H39ClN4O4Si/c1-15-13-16(11-12-19(15)34-35(6,7)24(2,3)4)30-20(31)14-25(5,29-22(30)28-23(32)33)17-9-8-10-18(27)21(17)26/h8-10,15-16,19H,11-14,27H2,1-7H3,(H,28,29)(H,32,33)/t15?,16?,19?,25-/m0/s1 |
| InChIKey | WIVCHFJLSRLPTH-QBTWFQSBSA-N |
| XLogP | 5.57 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.15 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|